C12H16N2OS — CID 39106663
3-(6-ethoxy-1,3-benzothiazol-2-yl)propan-1-amine (PubChem CID 39106663) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-(6-ethoxy-1,3-benzothiazol-2-yl)propan-1-amine.
| Compound Name | 3-(6-ethoxy-1,3-benzothiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 39106663 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-(6-ethoxy-1,3-benzothiazol-2-yl)propan-1-amine |
| SMILES | CCOc1ccc2nc(CCCN)sc2c1 |
| InChI | InChI=1S/C12H16N2OS/c1-2-15-9-5-6-10-11(8-9)16-12(14-10)4-3-7-13/h5-6,8H,2-4,7,13H2,1H3 |
| InChIKey | OVFCGYSDLKILPK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |