C14H20N2OS — CID 82189964
3-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propan-1-amine (PubChem CID 82189964) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 3-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propan-1-amine.
| Compound Name | 3-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propan-1-amine |
|---|---|
| PubChem CID | 82189964 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[(2-butyl-1,3-benzothiazol-6-yl)oxy]propan-1-amine |
| SMILES | CCCCc1nc2ccc(OCCCN)cc2s1 |
| InChI | InChI=1S/C14H20N2OS/c1-2-3-5-14-16-12-7-6-11(10-13(12)18-14)17-9-4-8-15/h6-7,10H,2-5,8-9,15H2,1H3 |
| InChIKey | MLFRENVZLPZQCD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|