C16H24N2S — CID 143097455
(2-octyl-1,3-benzothiazol-6-yl)methanamine (PubChem CID 143097455) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is (2-octyl-1,3-benzothiazol-6-yl)methanamine.
| Compound Name | (2-octyl-1,3-benzothiazol-6-yl)methanamine |
|---|---|
| PubChem CID | 143097455 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (2-octyl-1,3-benzothiazol-6-yl)methanamine |
| SMILES | CCCCCCCCc1nc2ccc(CN)cc2s1 |
| InChI | InChI=1S/C16H24N2S/c1-2-3-4-5-6-7-8-16-18-14-10-9-13(12-17)11-15(14)19-16/h9-11H,2-8,12,17H2,1H3 |
| InChIKey | WMYFCDJMQCNXHS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|