C12H16N2S — CID 45095376
3-(2-ethyl-1,3-benzothiazol-6-yl)propan-1-amine (PubChem CID 45095376) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 3-(2-ethyl-1,3-benzothiazol-6-yl)propan-1-amine.
| Compound Name | 3-(2-ethyl-1,3-benzothiazol-6-yl)propan-1-amine |
|---|---|
| PubChem CID | 45095376 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3-(2-ethyl-1,3-benzothiazol-6-yl)propan-1-amine |
| SMILES | CCc1nc2ccc(CCCN)cc2s1 |
| InChI | InChI=1S/C12H16N2S/c1-2-12-14-10-6-5-9(4-3-7-13)8-11(10)15-12/h5-6,8H,2-4,7,13H2,1H3 |
| InChIKey | SAJYFWOZZMMLNJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |