C10H11NO3S2 — CID 174833432
(2-ethyl-1,3-benzothiazol-6-yl)methanesulfonic acid (PubChem CID 174833432) has the molecular formula C10H11NO3S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is (2-ethyl-1,3-benzothiazol-6-yl)methanesulfonic acid.
| Compound Name | (2-ethyl-1,3-benzothiazol-6-yl)methanesulfonic acid |
|---|---|
| PubChem CID | 174833432 |
| Molecular Formula | C10H11NO3S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | (2-ethyl-1,3-benzothiazol-6-yl)methanesulfonic acid |
| SMILES | CCc1nc2ccc(CS(=O)(=O)O)cc2s1 |
| InChI | InChI=1S/C10H11NO3S2/c1-2-10-11-8-4-3-7(5-9(8)15-10)6-16(12,13)14/h3-5H,2,6H2,1H3,(H,12,13,14) |
| InChIKey | IKJWGBMIUPHVSH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|