About 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane
6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane (PubChem CID 142320199) has the molecular formula C15H23NS
and a molecular weight of 249.42 g/mol. Its IUPAC name is 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane.
Molecular Properties
| Compound Name | 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane |
| PubChem CID | 142320199 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane |
| SMILES | CC.CCc1nc2ccc(C(C)(C)C)cc2s1 |
| InChI | InChI=1S/C13H17NS.C2H6/c1-5-12-14-10-7-6-9(13(2,3)4)8-11(10)15-12;1-2/h6-8H,5H2,1-4H3;1-2H3 |
| InChIKey | QRLJDJVEYQJZCR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane?
The IUPAC name of 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane (CID 142320199) is 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane.
What is the SMILES notation for 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane?
The canonical SMILES for 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane is CC.CCc1nc2ccc(C(C)(C)C)cc2s1.
What is the InChIKey of 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane?
The InChIKey is QRLJDJVEYQJZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NS.C2H6/c1-5-12-14-10-7-6-9(13(2,3)4)8-11(10)15-12;1-2/h6-8H,5H2,1-4H3;1-2H3.
What are the key properties of 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane?
6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane has a molecular weight of 249.42 g/mol, XLogP of 5.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-ethyl-1,3-benzothiazole;ethane is sourced from PubChem (CID 142320199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).