C10H11NS — CID 22899424
2-ethyl-6-methyl-1,3-benzothiazole (PubChem CID 22899424) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 2-ethyl-6-methyl-1,3-benzothiazole.
| Compound Name | 2-ethyl-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 22899424 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2-ethyl-6-methyl-1,3-benzothiazole |
| SMILES | CCc1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C10H11NS/c1-3-10-11-8-5-4-7(2)6-9(8)12-10/h4-6H,3H2,1-2H3 |
| InChIKey | DJXUMQYYDFNLSA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |