C9H9NS2 — CID 137419548
(6-methyl-1,3-benzothiazol-2-yl)methanethiol (PubChem CID 137419548) has the molecular formula C9H9NS2 and a molecular weight of 195.31 g/mol. Its IUPAC name is (6-methyl-1,3-benzothiazol-2-yl)methanethiol.
| Compound Name | (6-methyl-1,3-benzothiazol-2-yl)methanethiol |
|---|---|
| PubChem CID | 137419548 |
| Molecular Formula | C9H9NS2 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | (6-methyl-1,3-benzothiazol-2-yl)methanethiol |
| SMILES | Cc1ccc2nc(CS)sc2c1 |
| InChI | InChI=1S/C9H9NS2/c1-6-2-3-7-8(4-6)12-9(5-11)10-7/h2-4,11H,5H2,1H3 |
| InChIKey | HDYXDABQKSTWIH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|