About 2,6-bis(2-methylpropyl)-1,3-benzothiazole
2,6-bis(2-methylpropyl)-1,3-benzothiazole (PubChem CID 58138489) has the molecular formula C15H21NS
and a molecular weight of 247.41 g/mol. Its IUPAC name is 2,6-bis(2-methylpropyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2,6-bis(2-methylpropyl)-1,3-benzothiazole |
| PubChem CID | 58138489 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2,6-bis(2-methylpropyl)-1,3-benzothiazole |
| SMILES | CC(C)Cc1ccc2nc(CC(C)C)sc2c1 |
| InChI | InChI=1S/C15H21NS/c1-10(2)7-12-5-6-13-14(9-12)17-15(16-13)8-11(3)4/h5-6,9-11H,7-8H2,1-4H3 |
| InChIKey | JSGIZBYZCSSMFQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-bis(2-methylpropyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(2-methylpropyl)-1,3-benzothiazole?
The IUPAC name of 2,6-bis(2-methylpropyl)-1,3-benzothiazole (CID 58138489) is 2,6-bis(2-methylpropyl)-1,3-benzothiazole.
What is the SMILES notation for 2,6-bis(2-methylpropyl)-1,3-benzothiazole?
The canonical SMILES for 2,6-bis(2-methylpropyl)-1,3-benzothiazole is CC(C)Cc1ccc2nc(CC(C)C)sc2c1.
What is the InChIKey of 2,6-bis(2-methylpropyl)-1,3-benzothiazole?
The InChIKey is JSGIZBYZCSSMFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NS/c1-10(2)7-12-5-6-13-14(9-12)17-15(16-13)8-11(3)4/h5-6,9-11H,7-8H2,1-4H3.
What are the key properties of 2,6-bis(2-methylpropyl)-1,3-benzothiazole?
2,6-bis(2-methylpropyl)-1,3-benzothiazole has a molecular weight of 247.41 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(2-methylpropyl)-1,3-benzothiazole is sourced from PubChem (CID 58138489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).