C11H14N2S — CID 20771989
6-(2-methylpropyl)-1,3-benzothiazol-2-amine (PubChem CID 20771989) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 6-(2-methylpropyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(2-methylpropyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 20771989 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 6-(2-methylpropyl)-1,3-benzothiazol-2-amine |
| SMILES | CC(C)Cc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C11H14N2S/c1-7(2)5-8-3-4-9-10(6-8)14-11(12)13-9/h3-4,6-7H,5H2,1-2H3,(H2,12,13) |
| InChIKey | FYCDTLZRLZPCIS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |