C13H18N2S — CID 118873963
6-(2-ethylbutyl)-1,3-benzothiazol-2-amine (PubChem CID 118873963) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 6-(2-ethylbutyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(2-ethylbutyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 118873963 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 6-(2-ethylbutyl)-1,3-benzothiazol-2-amine |
| SMILES | CCC(CC)Cc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C13H18N2S/c1-3-9(4-2)7-10-5-6-11-12(8-10)16-13(14)15-11/h5-6,8-9H,3-4,7H2,1-2H3,(H2,14,15) |
| InChIKey | CFWLTRPHGBHBFR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |