C10H13N3S — CID 65348658
6-(ethylaminomethyl)-1,3-benzothiazol-2-amine (PubChem CID 65348658) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 6-(ethylaminomethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(ethylaminomethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 65348658 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 6-(ethylaminomethyl)-1,3-benzothiazol-2-amine |
| SMILES | CCNCc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C10H13N3S/c1-2-12-6-7-3-4-8-9(5-7)14-10(11)13-8/h3-5,12H,2,6H2,1H3,(H2,11,13) |
| InChIKey | HBCFBPIPNANVFG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |