C25H43N3OS — CID 143717126
N-[(2-amino-1,3-benzothiazol-6-yl)methyl]pentanamide;dodecane (PubChem CID 143717126) has the molecular formula C25H43N3OS and a molecular weight of 433.71 g/mol. Its IUPAC name is N-[(2-amino-1,3-benzothiazol-6-yl)methyl]pentanamide;dodecane.
| Compound Name | N-[(2-amino-1,3-benzothiazol-6-yl)methyl]pentanamide;dodecane |
|---|---|
| PubChem CID | 143717126 |
| Molecular Formula | C25H43N3OS |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | N-[(2-amino-1,3-benzothiazol-6-yl)methyl]pentanamide;dodecane |
| SMILES | CCCCC(=O)NCc1ccc2nc(N)sc2c1.CCCCCCCCCCCC |
| InChI | InChI=1S/C13H17N3OS.C12H26/c1-2-3-4-12(17)15-8-9-5-6-10-11(7-9)18-13(14)16-10;1-3-5-7-9-11-12-10-8-6-4-2/h5-7H,2-4,8H2,1H3,(H2,14,16)(H,15,17);3-12H2,1-2H3 |
| InChIKey | YWKAGDOAYQMBTG-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|