C23H27N3O3S — CID 46289443
3-(2-acetamido-1,3-benzothiazol-6-yl)-N-[(4-butoxyphenyl)methyl]propanamide (PubChem CID 46289443) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 3-(2-acetamido-1,3-benzothiazol-6-yl)-N-[(4-butoxyphenyl)methyl]propanamide.
| Compound Name | 3-(2-acetamido-1,3-benzothiazol-6-yl)-N-[(4-butoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 46289443 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 3-(2-acetamido-1,3-benzothiazol-6-yl)-N-[(4-butoxyphenyl)methyl]propanamide |
| SMILES | CCCCOc1ccc(CNC(=O)CCc2ccc3nc(NC(C)=O)sc3c2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-3-4-13-29-19-9-5-18(6-10-19)15-24-22(28)12-8-17-7-11-20-21(14-17)30-23(26-20)25-16(2)27/h5-7,9-11,14H,3-4,8,12-13,15H2,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | CHHMBPCTCQAJAG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|