C14H21N3S — CID 65348790
6-[(dipropylamino)methyl]-1,3-benzothiazol-2-amine (PubChem CID 65348790) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 6-[(dipropylamino)methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(dipropylamino)methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 65348790 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 6-[(dipropylamino)methyl]-1,3-benzothiazol-2-amine |
| SMILES | CCCN(CCC)Cc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C14H21N3S/c1-3-7-17(8-4-2)10-11-5-6-12-13(9-11)18-14(15)16-12/h5-6,9H,3-4,7-8,10H2,1-2H3,(H2,15,16) |
| InChIKey | TXTLGHGHLGSANO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |