C17H19N3S — CID 65348285
6-[(N,2,4-trimethylanilino)methyl]-1,3-benzothiazol-2-amine (PubChem CID 65348285) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 6-[(N,2,4-trimethylanilino)methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(N,2,4-trimethylanilino)methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 65348285 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 6-[(N,2,4-trimethylanilino)methyl]-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(N(C)Cc2ccc3nc(N)sc3c2)c(C)c1 |
| InChI | InChI=1S/C17H19N3S/c1-11-4-7-15(12(2)8-11)20(3)10-13-5-6-14-16(9-13)21-17(18)19-14/h4-9H,10H2,1-3H3,(H2,18,19) |
| InChIKey | NDHKSOZXWQVJHB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |