C15H23N3S — CID 115325959
6-[(5-methylhexylamino)methyl]-1,3-benzothiazol-2-amine (PubChem CID 115325959) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is 6-[(5-methylhexylamino)methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(5-methylhexylamino)methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 115325959 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 6-[(5-methylhexylamino)methyl]-1,3-benzothiazol-2-amine |
| SMILES | CC(C)CCCCNCc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C15H23N3S/c1-11(2)5-3-4-8-17-10-12-6-7-13-14(9-12)19-15(16)18-13/h6-7,9,11,17H,3-5,8,10H2,1-2H3,(H2,16,18) |
| InChIKey | CHHRUYXOLNENSD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|