C14H23FN2 — CID 113287600
2-fluoro-4-[(5-methylhexylamino)methyl]aniline (PubChem CID 113287600) has the molecular formula C14H23FN2 and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-fluoro-4-[(5-methylhexylamino)methyl]aniline.
| Compound Name | 2-fluoro-4-[(5-methylhexylamino)methyl]aniline |
|---|---|
| PubChem CID | 113287600 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 2-fluoro-4-[(5-methylhexylamino)methyl]aniline |
| SMILES | CC(C)CCCCNCc1ccc(N)c(F)c1 |
| InChI | InChI=1S/C14H23FN2/c1-11(2)5-3-4-8-17-10-12-6-7-14(16)13(15)9-12/h6-7,9,11,17H,3-5,8,10,16H2,1-2H3 |
| InChIKey | HMMJRMPYHDOCII-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|