C12H16F4N2 — CID 113327736
2-fluoro-4-[(5,5,5-trifluoropentylamino)methyl]aniline (PubChem CID 113327736) has the molecular formula C12H16F4N2 and a molecular weight of 264.27 g/mol. Its IUPAC name is 2-fluoro-4-[(5,5,5-trifluoropentylamino)methyl]aniline.
| Compound Name | 2-fluoro-4-[(5,5,5-trifluoropentylamino)methyl]aniline |
|---|---|
| PubChem CID | 113327736 |
| Molecular Formula | C12H16F4N2 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-fluoro-4-[(5,5,5-trifluoropentylamino)methyl]aniline |
| SMILES | Nc1ccc(CNCCCCC(F)(F)F)cc1F |
| InChI | InChI=1S/C12H16F4N2/c13-10-7-9(3-4-11(10)17)8-18-6-2-1-5-12(14,15)16/h3-4,7,18H,1-2,5-6,8,17H2 |
| InChIKey | TWFMLXZGMHJWSU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|