C15H18F3N3 — CID 115520378
2-[(5,5,5-trifluoropentylamino)methyl]quinolin-4-amine (PubChem CID 115520378) has the molecular formula C15H18F3N3 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-[(5,5,5-trifluoropentylamino)methyl]quinolin-4-amine.
| Compound Name | 2-[(5,5,5-trifluoropentylamino)methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 115520378 |
| Molecular Formula | C15H18F3N3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-[(5,5,5-trifluoropentylamino)methyl]quinolin-4-amine |
| SMILES | Nc1cc(CNCCCCC(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C15H18F3N3/c16-15(17,18)7-3-4-8-20-10-11-9-13(19)12-5-1-2-6-14(12)21-11/h1-2,5-6,9,20H,3-4,7-8,10H2,(H2,19,21) |
| InChIKey | GBJXNTVHAAPPLD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|