C14H14F3N — CID 164668878
4-methyl-2-(4,4,4-trifluorobutyl)quinoline (PubChem CID 164668878) has the molecular formula C14H14F3N and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-methyl-2-(4,4,4-trifluorobutyl)quinoline.
| Compound Name | 4-methyl-2-(4,4,4-trifluorobutyl)quinoline |
|---|---|
| PubChem CID | 164668878 |
| Molecular Formula | C14H14F3N |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-methyl-2-(4,4,4-trifluorobutyl)quinoline |
| SMILES | Cc1cc(CCCC(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C14H14F3N/c1-10-9-11(5-4-8-14(15,16)17)18-13-7-3-2-6-12(10)13/h2-3,6-7,9H,4-5,8H2,1H3 |
| InChIKey | IKXFLPBNDUNGEV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |