About acridine
acridine (PubChem CID 9215) has the molecular formula C13H9N
and a molecular weight of 179.22 g/mol. Its IUPAC name is acridine.
Molecular Properties
| Compound Name | acridine |
| PubChem CID | 9215 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | acridine |
| SMILES | c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| InChIKey | DZBUGLKDJFMEHC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine?
The IUPAC name of acridine (CID 9215) is acridine.
What is the SMILES notation for acridine?
The canonical SMILES for acridine is c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine?
The InChIKey is DZBUGLKDJFMEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H.
What are the key properties of acridine?
acridine has a molecular weight of 179.22 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acridine is sourced from PubChem (CID 9215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).