About benzo[c]acridine
benzo[c]acridine (PubChem CID 9181) has the molecular formula C17H11N
and a molecular weight of 229.28 g/mol. Its IUPAC name is benzo[c]acridine.
Molecular Properties
| Compound Name | benzo[c]acridine |
| PubChem CID | 9181 |
| Molecular Formula | C17H11N |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | benzo[c]acridine |
| SMILES | c1ccc2nc3c(ccc4ccccc43)cc2c1 |
| InChI | InChI=1S/C17H11N/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)18-17(14)15/h1-11H |
| InChIKey | OAPPEBNXKAKQGS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[c]acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[c]acridine?
The IUPAC name of benzo[c]acridine (CID 9181) is benzo[c]acridine.
What is the SMILES notation for benzo[c]acridine?
The canonical SMILES for benzo[c]acridine is c1ccc2nc3c(ccc4ccccc43)cc2c1.
What is the InChIKey of benzo[c]acridine?
The InChIKey is OAPPEBNXKAKQGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N/c1-3-7-15-12(5-1)9-10-14-11-13-6-2-4-8-16(13)18-17(14)15/h1-11H.
What are the key properties of benzo[c]acridine?
benzo[c]acridine has a molecular weight of 229.28 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[c]acridine is sourced from PubChem (CID 9181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).