3,6-Diamino-10-methylacridinium Chloride

C14H14ClN3 — CID 6842

IUPAC10-methylacridin-10-ium-3,6-diamine chloride
SMILESC[N+]1=C2C=C(C=CC2=CC3=C1C=C(C=C3)N)N.[Cl-]
InChIInChI=1S/C14H13N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;/h2-8H,1H3,(H3,15,16);1H
InChIKeyKKAJSJJFBSOMGS-UHFFFAOYSA-N
MW259.73 g/mol
LogP
Rot. Bonds

About 3,6-Diamino-10-methylacridinium Chloride

3,6-Diamino-10-methylacridinium Chloride (PubChem CID 6842) has the molecular formula C14H14ClN3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 10-methylacridin-10-ium-3,6-diamine chloride.

Molecular Properties

Compound Name3,6-Diamino-10-methylacridinium Chloride
PubChem CID6842
Molecular FormulaC14H14ClN3
Molecular Weight259.73 g/mol
Exact Mass259.09
IUPAC Name10-methylacridin-10-ium-3,6-diamine chloride
SMILESC[N+]1=C2C=C(C=CC2=CC3=C1C=C(C=C3)N)N.[Cl-]
InChIInChI=1S/C14H13N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;/h2-8H,1H3,(H3,15,16);1H
InChIKeyKKAJSJJFBSOMGS-UHFFFAOYSA-N
XLogP
TPSA55.90 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms18
Complexity255

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 3,6-Diamino-10-methylacridinium Chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,6-Diamino-10-methylacridinium Chloride?
The IUPAC name of 3,6-Diamino-10-methylacridinium Chloride (CID 6842) is 10-methylacridin-10-ium-3,6-diamine chloride.
What is the SMILES notation for 3,6-Diamino-10-methylacridinium Chloride?
The canonical SMILES for 3,6-Diamino-10-methylacridinium Chloride is C[N+]1=C2C=C(C=CC2=CC3=C1C=C(C=C3)N)N.[Cl-].
What is the InChIKey of 3,6-Diamino-10-methylacridinium Chloride?
The InChIKey is KKAJSJJFBSOMGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;/h2-8H,1H3,(H3,15,16);1H.
What are the key properties of 3,6-Diamino-10-methylacridinium Chloride?
3,6-Diamino-10-methylacridinium Chloride has a molecular weight of 259.73 g/mol, XLogP of not available, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-Diamino-10-methylacridinium Chloride is sourced from PubChem (CID 6842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).