About Acridine Orange Base
Acridine Orange Base (PubChem CID 62344) has the molecular formula C17H19N3
and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine.
Molecular Properties
| Compound Name | Acridine Orange Base |
| PubChem CID | 62344 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine |
| SMILES | CN(C)C1=CC2=C(C=C1)C=C3C=CC(=CC3=N2)N(C)C |
| InChI | InChI=1S/C17H19N3/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14/h5-11H,1-4H3 |
| InChIKey | DPKHZNPWBDQZCN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 19.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | 298 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze Acridine Orange Base with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Acridine Orange Base?
The IUPAC name of Acridine Orange Base (CID 62344) is 3-N,3-N,6-N,6-N-tetramethylacridine-3,6-diamine.
What is the SMILES notation for Acridine Orange Base?
The canonical SMILES for Acridine Orange Base is CN(C)C1=CC2=C(C=C1)C=C3C=CC(=CC3=N2)N(C)C.
What is the InChIKey of Acridine Orange Base?
The InChIKey is DPKHZNPWBDQZCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3/c1-19(2)14-7-5-12-9-13-6-8-15(20(3)4)11-17(13)18-16(12)10-14/h5-11H,1-4H3.
What are the key properties of Acridine Orange Base?
Acridine Orange Base has a molecular weight of 265.35 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Acridine Orange Base is sourced from PubChem (CID 62344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).