C15H23F3N2 — CID 115520442
1-phenyl-N'-(5,5,5-trifluoropentyl)butane-1,4-diamine (PubChem CID 115520442) has the molecular formula C15H23F3N2 and a molecular weight of 288.36 g/mol. Its IUPAC name is 1-phenyl-N'-(5,5,5-trifluoropentyl)butane-1,4-diamine.
| Compound Name | 1-phenyl-N'-(5,5,5-trifluoropentyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 115520442 |
| Molecular Formula | C15H23F3N2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-phenyl-N'-(5,5,5-trifluoropentyl)butane-1,4-diamine |
| SMILES | NC(CCCNCCCCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H23F3N2/c16-15(17,18)10-4-5-11-20-12-6-9-14(19)13-7-2-1-3-8-13/h1-3,7-8,14,20H,4-6,9-12,19H2 |
| InChIKey | DYSDJTAGCJAWAI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|