About 2-pentylquinolin-4-amine
2-pentylquinolin-4-amine (PubChem CID 14082309) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-pentylquinolin-4-amine.
Molecular Properties
| Compound Name | 2-pentylquinolin-4-amine |
| PubChem CID | 14082309 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2-pentylquinolin-4-amine |
| SMILES | CCCCCc1cc(N)c2ccccc2n1 |
| InChI | InChI=1S/C14H18N2/c1-2-3-4-7-11-10-13(15)12-8-5-6-9-14(12)16-11/h5-6,8-10H,2-4,7H2,1H3,(H2,15,16) |
| InChIKey | QFIMKADQTCVGIW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-pentylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentylquinolin-4-amine?
The IUPAC name of 2-pentylquinolin-4-amine (CID 14082309) is 2-pentylquinolin-4-amine.
What is the SMILES notation for 2-pentylquinolin-4-amine?
The canonical SMILES for 2-pentylquinolin-4-amine is CCCCCc1cc(N)c2ccccc2n1.
What is the InChIKey of 2-pentylquinolin-4-amine?
The InChIKey is QFIMKADQTCVGIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2/c1-2-3-4-7-11-10-13(15)12-8-5-6-9-14(12)16-11/h5-6,8-10H,2-4,7H2,1H3,(H2,15,16).
What are the key properties of 2-pentylquinolin-4-amine?
2-pentylquinolin-4-amine has a molecular weight of 214.31 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylquinolin-4-amine is sourced from PubChem (CID 14082309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).