C22H32N2O — CID 174849155
4,5-dihydro-1,3-oxazole;2,4-dipentylquinoline (PubChem CID 174849155) has the molecular formula C22H32N2O and a molecular weight of 340.51 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazole;2,4-dipentylquinoline.
| Compound Name | 4,5-dihydro-1,3-oxazole;2,4-dipentylquinoline |
|---|---|
| PubChem CID | 174849155 |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 4,5-dihydro-1,3-oxazole;2,4-dipentylquinoline |
| SMILES | C1=NCCO1.CCCCCc1cc(CCCCC)c2ccccc2n1 |
| InChI | InChI=1S/C19H27N.C3H5NO/c1-3-5-7-11-16-15-17(12-8-6-4-2)20-19-14-10-9-13-18(16)19;1-2-5-3-4-1/h9-10,13-15H,3-8,11-12H2,1-2H3;3H,1-2H2 |
| InChIKey | UISGFIQDLNULRN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|