About 4-ethyl-2-hexylquinoline
4-ethyl-2-hexylquinoline (PubChem CID 143260250) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is 4-ethyl-2-hexylquinoline.
Molecular Properties
| Compound Name | 4-ethyl-2-hexylquinoline |
| PubChem CID | 143260250 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 4-ethyl-2-hexylquinoline |
| SMILES | CCCCCCc1cc(CC)c2ccccc2n1 |
| InChI | InChI=1S/C17H23N/c1-3-5-6-7-10-15-13-14(4-2)16-11-8-9-12-17(16)18-15/h8-9,11-13H,3-7,10H2,1-2H3 |
| InChIKey | OOUQVUABLRZLMJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-hexylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-hexylquinoline?
The IUPAC name of 4-ethyl-2-hexylquinoline (CID 143260250) is 4-ethyl-2-hexylquinoline.
What is the SMILES notation for 4-ethyl-2-hexylquinoline?
The canonical SMILES for 4-ethyl-2-hexylquinoline is CCCCCCc1cc(CC)c2ccccc2n1.
What is the InChIKey of 4-ethyl-2-hexylquinoline?
The InChIKey is OOUQVUABLRZLMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N/c1-3-5-6-7-10-15-13-14(4-2)16-11-8-9-12-17(16)18-15/h8-9,11-13H,3-7,10H2,1-2H3.
What are the key properties of 4-ethyl-2-hexylquinoline?
4-ethyl-2-hexylquinoline has a molecular weight of 241.38 g/mol, XLogP of 4.92, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-hexylquinoline is sourced from PubChem (CID 143260250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).