About 2-octylquinoxaline
2-octylquinoxaline (PubChem CID 141276580) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-octylquinoxaline.
Molecular Properties
| Compound Name | 2-octylquinoxaline |
| PubChem CID | 141276580 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-octylquinoxaline |
| SMILES | CCCCCCCCc1cnc2ccccc2n1 |
| InChI | InChI=1S/C16H22N2/c1-2-3-4-5-6-7-10-14-13-17-15-11-8-9-12-16(15)18-14/h8-9,11-13H,2-7,10H2,1H3 |
| InChIKey | XKZBKXGRAUOHLR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylquinoxaline?
The IUPAC name of 2-octylquinoxaline (CID 141276580) is 2-octylquinoxaline.
What is the SMILES notation for 2-octylquinoxaline?
The canonical SMILES for 2-octylquinoxaline is CCCCCCCCc1cnc2ccccc2n1.
What is the InChIKey of 2-octylquinoxaline?
The InChIKey is XKZBKXGRAUOHLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2/c1-2-3-4-5-6-7-10-14-13-17-15-11-8-9-12-16(15)18-14/h8-9,11-13H,2-7,10H2,1H3.
What are the key properties of 2-octylquinoxaline?
2-octylquinoxaline has a molecular weight of 242.37 g/mol, XLogP of 4.53, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylquinoxaline is sourced from PubChem (CID 141276580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).