About 2-nonylquinolin-4-olate
2-nonylquinolin-4-olate (PubChem CID 162840210) has the molecular formula C18H24NO-
and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-nonylquinolin-4-olate.
Molecular Properties
| Compound Name | 2-nonylquinolin-4-olate |
| PubChem CID | 162840210 |
| Molecular Formula | C18H24NO- |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-nonylquinolin-4-olate |
| SMILES | CCCCCCCCCc1cc([O-])c2ccccc2n1 |
| InChI | InChI=1S/C18H25NO/c1-2-3-4-5-6-7-8-11-15-14-18(20)16-12-9-10-13-17(16)19-15/h9-10,12-14H,2-8,11H2,1H3,(H,19,20)/p-1 |
| InChIKey | KKRXDNYRUZGPFM-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-nonylquinolin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonylquinolin-4-olate?
The IUPAC name of 2-nonylquinolin-4-olate (CID 162840210) is 2-nonylquinolin-4-olate.
What is the SMILES notation for 2-nonylquinolin-4-olate?
The canonical SMILES for 2-nonylquinolin-4-olate is CCCCCCCCCc1cc([O-])c2ccccc2n1.
What is the InChIKey of 2-nonylquinolin-4-olate?
The InChIKey is KKRXDNYRUZGPFM-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H25NO/c1-2-3-4-5-6-7-8-11-15-14-18(20)16-12-9-10-13-17(16)19-15/h9-10,12-14H,2-8,11H2,1H3,(H,19,20)/p-1.
What are the key properties of 2-nonylquinolin-4-olate?
2-nonylquinolin-4-olate has a molecular weight of 270.40 g/mol, XLogP of 4.60, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonylquinolin-4-olate is sourced from PubChem (CID 162840210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).