C12H14BrF4N — CID 115491476
N-[(4-bromo-3-fluorophenyl)methyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 115491476) has the molecular formula C12H14BrF4N and a molecular weight of 328.15 g/mol. Its IUPAC name is N-[(4-bromo-3-fluorophenyl)methyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[(4-bromo-3-fluorophenyl)methyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 115491476 |
| Molecular Formula | C12H14BrF4N |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | N-[(4-bromo-3-fluorophenyl)methyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | Fc1cc(CNCCCCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C12H14BrF4N/c13-10-4-3-9(7-11(10)14)8-18-6-2-1-5-12(15,16)17/h3-4,7,18H,1-2,5-6,8H2 |
| InChIKey | YESIWUVMEYBZKI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|