C11H14BrF3N2 — CID 113410128
N'-[[4-bromo-3-(trifluoromethyl)phenyl]methyl]propane-1,3-diamine (PubChem CID 113410128) has the molecular formula C11H14BrF3N2 and a molecular weight of 311.15 g/mol. Its IUPAC name is N'-[[4-bromo-3-(trifluoromethyl)phenyl]methyl]propane-1,3-diamine.
| Compound Name | N'-[[4-bromo-3-(trifluoromethyl)phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 113410128 |
| Molecular Formula | C11H14BrF3N2 |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N'-[[4-bromo-3-(trifluoromethyl)phenyl]methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14BrF3N2/c12-10-3-2-8(7-17-5-1-4-16)6-9(10)11(13,14)15/h2-3,6,17H,1,4-5,7,16H2 |
| InChIKey | VHPBEPKBFOAXJQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|