C14H15F4N — CID 103851985
N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]hex-5-yn-1-amine (PubChem CID 103851985) has the molecular formula C14H15F4N and a molecular weight of 273.27 g/mol. Its IUPAC name is N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]hex-5-yn-1-amine.
| Compound Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 103851985 |
| Molecular Formula | C14H15F4N |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]hex-5-yn-1-amine |
| SMILES | C#CCCCCNCc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F4N/c1-2-3-4-5-8-19-10-11-6-7-13(15)12(9-11)14(16,17)18/h1,6-7,9,19H,3-5,8,10H2 |
| InChIKey | KIJRXCBPLLTRFK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|