C13H13F4N — CID 113338465
N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]pent-4-yn-1-amine (PubChem CID 113338465) has the molecular formula C13H13F4N and a molecular weight of 259.25 g/mol. Its IUPAC name is N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]pent-4-yn-1-amine.
| Compound Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]pent-4-yn-1-amine |
|---|---|
| PubChem CID | 113338465 |
| Molecular Formula | C13H13F4N |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]pent-4-yn-1-amine |
| SMILES | C#CCCCNCc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F4N/c1-2-3-4-7-18-9-10-5-6-12(14)11(8-10)13(15,16)17/h1,5-6,8,18H,3-4,7,9H2 |
| InChIKey | ASVNVRUNXMUDMI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|