C10H13BrFNOS — CID 115702492
N-[(4-bromo-3-fluorophenyl)methyl]-2-methylsulfinylethanamine (PubChem CID 115702492) has the molecular formula C10H13BrFNOS and a molecular weight of 294.19 g/mol. Its IUPAC name is N-[(4-bromo-3-fluorophenyl)methyl]-2-methylsulfinylethanamine.
| Compound Name | N-[(4-bromo-3-fluorophenyl)methyl]-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 115702492 |
| Molecular Formula | C10H13BrFNOS |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | N-[(4-bromo-3-fluorophenyl)methyl]-2-methylsulfinylethanamine |
| SMILES | CS(=O)CCNCc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C10H13BrFNOS/c1-15(14)5-4-13-7-8-2-3-9(11)10(12)6-8/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | PQDBJLSOPFAWKW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|