C10H13BrClNOS — CID 115660120
N-[(2-bromo-5-chlorophenyl)methyl]-2-methylsulfinylethanamine (PubChem CID 115660120) has the molecular formula C10H13BrClNOS and a molecular weight of 310.64 g/mol. Its IUPAC name is N-[(2-bromo-5-chlorophenyl)methyl]-2-methylsulfinylethanamine.
| Compound Name | N-[(2-bromo-5-chlorophenyl)methyl]-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 115660120 |
| Molecular Formula | C10H13BrClNOS |
| Molecular Weight | 310.64 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | N-[(2-bromo-5-chlorophenyl)methyl]-2-methylsulfinylethanamine |
| SMILES | CS(=O)CCNCc1cc(Cl)ccc1Br |
| InChI | InChI=1S/C10H13BrClNOS/c1-15(14)5-4-13-7-8-6-9(12)2-3-10(8)11/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | HLLANPWQJAJOCN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.64 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|