C11H16ClNO2S — CID 115632586
N-[(5-chloro-2-methoxyphenyl)methyl]-2-methylsulfinylethanamine (PubChem CID 115632586) has the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-2-methylsulfinylethanamine.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-methylsulfinylethanamine |
|---|---|
| PubChem CID | 115632586 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-2-methylsulfinylethanamine |
| SMILES | COc1ccc(Cl)cc1CNCCS(C)=O |
| InChI | InChI=1S/C11H16ClNO2S/c1-15-11-4-3-10(12)7-9(11)8-13-5-6-16(2)14/h3-4,7,13H,5-6,8H2,1-2H3 |
| InChIKey | DWLINLXXTXPMJN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|