C10H12ClNO2 — CID 115222884
2-[(5-chloro-2-methoxyphenyl)methylamino]acetaldehyde (PubChem CID 115222884) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)methylamino]acetaldehyde.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)methylamino]acetaldehyde |
|---|---|
| PubChem CID | 115222884 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)methylamino]acetaldehyde |
| SMILES | COc1ccc(Cl)cc1CNCC=O |
| InChI | InChI=1S/C10H12ClNO2/c1-14-10-3-2-9(11)6-8(10)7-12-4-5-13/h2-3,5-6,12H,4,7H2,1H3 |
| InChIKey | OQWQFWZMMJBGJN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|