C9H9BrClNO2 — CID 115193549
N-[(5-chloro-2-methoxyphenyl)methyl]carbamoyl bromide (PubChem CID 115193549) has the molecular formula C9H9BrClNO2 and a molecular weight of 278.53 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]carbamoyl bromide.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115193549 |
| Molecular Formula | C9H9BrClNO2 |
| Molecular Weight | 278.53 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]carbamoyl bromide |
| SMILES | COc1ccc(Cl)cc1CNC(=O)Br |
| InChI | InChI=1S/C9H9BrClNO2/c1-14-8-3-2-7(11)4-6(8)5-12-9(10)13/h2-4H,5H2,1H3,(H,12,13) |
| InChIKey | JSKGBZQQNBQMPV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|