C8H6BrCl2NO — CID 115193657
N-[(2,4-dichlorophenyl)methyl]carbamoyl bromide (PubChem CID 115193657) has the molecular formula C8H6BrCl2NO and a molecular weight of 282.95 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]carbamoyl bromide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]carbamoyl bromide |
|---|---|
| PubChem CID | 115193657 |
| Molecular Formula | C8H6BrCl2NO |
| Molecular Weight | 282.95 g/mol |
| Exact Mass | 280.90 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]carbamoyl bromide |
| SMILES | O=C(Br)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6BrCl2NO/c9-8(13)12-4-5-1-2-6(10)3-7(5)11/h1-3H,4H2,(H,12,13) |
| InChIKey | LSRVQCIVNZLYBP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.95 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|