C11H14Cl2N2O — CID 115154234
3-amino-N-[(2,4-dichlorophenyl)methyl]butanamide (PubChem CID 115154234) has the molecular formula C11H14Cl2N2O and a molecular weight of 261.15 g/mol. Its IUPAC name is 3-amino-N-[(2,4-dichlorophenyl)methyl]butanamide.
| Compound Name | 3-amino-N-[(2,4-dichlorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 115154234 |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-amino-N-[(2,4-dichlorophenyl)methyl]butanamide |
| SMILES | CC(N)CC(=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O/c1-7(14)4-11(16)15-6-8-2-3-9(12)5-10(8)13/h2-3,5,7H,4,6,14H2,1H3,(H,15,16) |
| InChIKey | UXOXGPQVSOQAJU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |