C9H8Cl2INO — CID 70030657
N-[(2,4-dichlorophenyl)methyl]-2-iodoacetamide (PubChem CID 70030657) has the molecular formula C9H8Cl2INO and a molecular weight of 343.98 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-iodoacetamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-iodoacetamide |
|---|---|
| PubChem CID | 70030657 |
| Molecular Formula | C9H8Cl2INO |
| Molecular Weight | 343.98 g/mol |
| Exact Mass | 342.90 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-iodoacetamide |
| SMILES | O=C(CI)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2INO/c10-7-2-1-6(8(11)3-7)5-13-9(14)4-12/h1-3H,4-5H2,(H,13,14) |
| InChIKey | DHCFWAYYADZLSU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.98 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|