C15H21Cl2N2O+ — CID 8896107
2-(azepan-1-ium-1-yl)-N-[(2,4-dichlorophenyl)methyl]acetamide (PubChem CID 8896107) has the molecular formula C15H21Cl2N2O+ and a molecular weight of 316.25 g/mol. Its IUPAC name is 2-(azepan-1-ium-1-yl)-N-[(2,4-dichlorophenyl)methyl]acetamide.
| Compound Name | 2-(azepan-1-ium-1-yl)-N-[(2,4-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8896107 |
| Molecular Formula | C15H21Cl2N2O+ |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-(azepan-1-ium-1-yl)-N-[(2,4-dichlorophenyl)methyl]acetamide |
| SMILES | O=C(C[NH+]1CCCCCC1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O/c16-13-6-5-12(14(17)9-13)10-18-15(20)11-19-7-3-1-2-4-8-19/h5-6,9H,1-4,7-8,10-11H2,(H,18,20)/p+1 |
| InChIKey | AAEIXPPOMCFGPW-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |