C14H19Cl2N2O2+ — CID 2634680
2-(2,4-dichlorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)acetamide (PubChem CID 2634680) has the molecular formula C14H19Cl2N2O2+ and a molecular weight of 318.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 2634680 |
| Molecular Formula | C14H19Cl2N2O2+ |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c15-12-2-1-11(13(16)10-12)9-14(19)17-3-4-18-5-7-20-8-6-18/h1-2,10H,3-9H2,(H,17,19)/p+1 |
| InChIKey | MIXUATSUYARKGM-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |