C15H23N2O4+ — CID 71598518
2-(4-hydroxy-3-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)acetamide (PubChem CID 71598518) has the molecular formula C15H23N2O4+ and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)acetamide.
| Compound Name | 2-(4-hydroxy-3-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 71598518 |
| Molecular Formula | C15H23N2O4+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
| SMILES | COc1cc(CC(=O)NCC[NH+]2CCOCC2)ccc1O |
| InChI | InChI=1S/C15H22N2O4/c1-20-14-10-12(2-3-13(14)18)11-15(19)16-4-5-17-6-8-21-9-7-17/h2-3,10,18H,4-9,11H2,1H3,(H,16,19)/p+1 |
| InChIKey | CZUQAXAWBOEBHN-UHFFFAOYSA-O |
| XLogP | -1.03 |
| TPSA | 72.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |