C16H25N4O3S+ — CID 135689874
1-[(E)-1-(2-hydroxy-5-methoxyphenyl)ethylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 135689874) has the molecular formula C16H25N4O3S+ and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[(E)-1-(2-hydroxy-5-methoxyphenyl)ethylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-1-(2-hydroxy-5-methoxyphenyl)ethylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 135689874 |
| Molecular Formula | C16H25N4O3S+ |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-[(E)-1-(2-hydroxy-5-methoxyphenyl)ethylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | COc1ccc(O)c(/C(C)=N/NC(=S)NCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C16H24N4O3S/c1-12(14-11-13(22-2)3-4-15(14)21)18-19-16(24)17-5-6-20-7-9-23-10-8-20/h3-4,11,21H,5-10H2,1-2H3,(H2,17,19,24)/p+1/b18-12+ |
| InChIKey | JKRJSPAHDPFTDC-LDADJPATSA-O |
| XLogP | -0.50 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|