C18H27N4O2S+ — CID 135689852
1-[(E)-(8-hydroxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 135689852) has the molecular formula C18H27N4O2S+ and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[(E)-(8-hydroxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-(8-hydroxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 135689852 |
| Molecular Formula | C18H27N4O2S+ |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[(E)-(8-hydroxy-5-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | Cc1ccc(O)c2c1CCC/C2=N\NC(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C18H26N4O2S/c1-13-5-6-16(23)17-14(13)3-2-4-15(17)20-21-18(25)19-7-8-22-9-11-24-12-10-22/h5-6,23H,2-4,7-12H2,1H3,(H2,19,21,25)/p+1/b20-15+ |
| InChIKey | RCVOGXGUJYGNTL-HMMYKYKNSA-O |
| XLogP | 0.12 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|