C14H27N4OS+ — CID 7934242
1-[(Z)-[(3R)-3-methylcyclohexylidene]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 7934242) has the molecular formula C14H27N4OS+ and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-[(Z)-[(3R)-3-methylcyclohexylidene]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(Z)-[(3R)-3-methylcyclohexylidene]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 7934242 |
| Molecular Formula | C14H27N4OS+ |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-[(Z)-[(3R)-3-methylcyclohexylidene]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | C[C@@H]1CCC/C(=N/NC(=S)NCC[NH+]2CCOCC2)C1 |
| InChI | InChI=1S/C14H26N4OS/c1-12-3-2-4-13(11-12)16-17-14(20)15-5-6-18-7-9-19-10-8-18/h12H,2-11H2,1H3,(H2,15,17,20)/p+1/b16-13-/t12-/m1/s1 |
| InChIKey | NEQSVXGMVYPFJZ-CZWGUHTPSA-O |
| XLogP | -0.07 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|