C16H25N4O2S+ — CID 9392607
1-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 9392607) has the molecular formula C16H25N4O2S+ and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 9392607 |
| Molecular Formula | C16H25N4O2S+ |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-[(Z)-[5-[(1R,2S)-2-methylcyclopropyl]furan-2-yl]methylideneamino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | C[C@H]1C[C@H]1c1ccc(/C=N\NC(=S)NCC[NH+]2CCOCC2)o1 |
| InChI | InChI=1S/C16H24N4O2S/c1-12-10-14(12)15-3-2-13(22-15)11-18-19-16(23)17-4-5-20-6-8-21-9-7-20/h2-3,11-12,14H,4-10H2,1H3,(H2,17,19,23)/p+1/b18-11-/t12-,14+/m0/s1 |
| InChIKey | LNTQZDLJDQDRBT-WGFSPCAYSA-O |
| XLogP | 0.12 |
| TPSA | 63.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|